C11H21N3O5 — CID 103158593
4-[[[2-(dimethylamino)-2-oxoethyl]-methylcarbamoyl]amino]-3-methoxybutanoic acid (PubChem CID 103158593) has the molecular formula C11H21N3O5 and a molecular weight of 275.31 g/mol. Its IUPAC name is 4-[[[2-(dimethylamino)-2-oxoethyl]-methylcarbamoyl]amino]-3-methoxybutanoic acid.
| Compound Name | 4-[[[2-(dimethylamino)-2-oxoethyl]-methylcarbamoyl]amino]-3-methoxybutanoic acid |
|---|---|
| PubChem CID | 103158593 |
| Molecular Formula | C11H21N3O5 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | 4-[[[2-(dimethylamino)-2-oxoethyl]-methylcarbamoyl]amino]-3-methoxybutanoic acid |
| SMILES | COC(CNC(=O)N(C)CC(=O)N(C)C)CC(=O)O |
| InChI | InChI=1S/C11H21N3O5/c1-13(2)9(15)7-14(3)11(18)12-6-8(19-4)5-10(16)17/h8H,5-7H2,1-4H3,(H,12,18)(H,16,17) |
| InChIKey | SDVVNQGUPJEJAH-UHFFFAOYSA-N |
| XLogP | -0.79 |
| TPSA | 99.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |