C10H18N2O6 — CID 103158193
3-methoxy-4-[[(2-methoxy-2-oxoethyl)-methylcarbamoyl]amino]butanoic acid (PubChem CID 103158193) has the molecular formula C10H18N2O6 and a molecular weight of 262.26 g/mol. Its IUPAC name is 3-methoxy-4-[[(2-methoxy-2-oxoethyl)-methylcarbamoyl]amino]butanoic acid.
| Compound Name | 3-methoxy-4-[[(2-methoxy-2-oxoethyl)-methylcarbamoyl]amino]butanoic acid |
|---|---|
| PubChem CID | 103158193 |
| Molecular Formula | C10H18N2O6 |
| Molecular Weight | 262.26 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | 3-methoxy-4-[[(2-methoxy-2-oxoethyl)-methylcarbamoyl]amino]butanoic acid |
| SMILES | COC(=O)CN(C)C(=O)NCC(CC(=O)O)OC |
| InChI | InChI=1S/C10H18N2O6/c1-12(6-9(15)18-3)10(16)11-5-7(17-2)4-8(13)14/h7H,4-6H2,1-3H3,(H,11,16)(H,13,14) |
| InChIKey | QMNNXGUMWKAKHX-UHFFFAOYSA-N |
| XLogP | -0.71 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.26 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |