(3R)-3,5-dimethoxy-5-oxopentanoic acid

C7H12O5 — CID 14895219

IUPAC(3R)-3,5-dimethoxy-5-oxopentanoic acid
SMILESCOC(=O)C[C@@H](CC(=O)O)OC
InChIInChI=1S/C7H12O5/c1-11-5(3-6(8)9)4-7(10)12-2/h5H,3-4H2,1-2H3,(H,8,9)/t5-/m1/s1
InChIKeySEQJFZVAGVYXGO-RXMQYKEDSA-N
MW176.17 g/mol
LogP0.04
Rot. Bonds5

About (3R)-3,5-dimethoxy-5-oxopentanoic acid

(3R)-3,5-dimethoxy-5-oxopentanoic acid (PubChem CID 14895219) has the molecular formula C7H12O5 and a molecular weight of 176.17 g/mol. Its IUPAC name is (3R)-3,5-dimethoxy-5-oxopentanoic acid.

Molecular Properties

Compound Name(3R)-3,5-dimethoxy-5-oxopentanoic acid
PubChem CID14895219
Molecular FormulaC7H12O5
Molecular Weight176.17 g/mol
Exact Mass176.07
IUPAC Name(3R)-3,5-dimethoxy-5-oxopentanoic acid
SMILESCOC(=O)C[C@@H](CC(=O)O)OC
InChIInChI=1S/C7H12O5/c1-11-5(3-6(8)9)4-7(10)12-2/h5H,3-4H2,1-2H3,(H,8,9)/t5-/m1/s1
InChIKeySEQJFZVAGVYXGO-RXMQYKEDSA-N
XLogP0.04
TPSA72.83 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500176.17
LogP ≤ 50.04
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze (3R)-3,5-dimethoxy-5-oxopentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (3R)-3,5-dimethoxy-5-oxopentanoic acid?
The IUPAC name of (3R)-3,5-dimethoxy-5-oxopentanoic acid (CID 14895219) is (3R)-3,5-dimethoxy-5-oxopentanoic acid.
What is the SMILES notation for (3R)-3,5-dimethoxy-5-oxopentanoic acid?
The canonical SMILES for (3R)-3,5-dimethoxy-5-oxopentanoic acid is COC(=O)C[C@@H](CC(=O)O)OC.
What is the InChIKey of (3R)-3,5-dimethoxy-5-oxopentanoic acid?
The InChIKey is SEQJFZVAGVYXGO-RXMQYKEDSA-N. The full InChI is InChI=1S/C7H12O5/c1-11-5(3-6(8)9)4-7(10)12-2/h5H,3-4H2,1-2H3,(H,8,9)/t5-/m1/s1.
What are the key properties of (3R)-3,5-dimethoxy-5-oxopentanoic acid?
(3R)-3,5-dimethoxy-5-oxopentanoic acid has a molecular weight of 176.17 g/mol, XLogP of 0.04, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-3,5-dimethoxy-5-oxopentanoic acid is sourced from PubChem (CID 14895219), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).