About 4-methoxyhexan-2-one;3-methoxypentanoic acid
4-methoxyhexan-2-one;3-methoxypentanoic acid (PubChem CID 157200389) has the molecular formula C13H26O5
and a molecular weight of 262.35 g/mol. Its IUPAC name is 4-methoxyhexan-2-one;3-methoxypentanoic acid.
Molecular Properties
| Compound Name | 4-methoxyhexan-2-one;3-methoxypentanoic acid |
| PubChem CID | 157200389 |
| Molecular Formula | C13H26O5 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.18 |
| IUPAC Name | 4-methoxyhexan-2-one;3-methoxypentanoic acid |
| SMILES | CCC(CC(=O)O)OC.CCC(CC(C)=O)OC |
| InChI | InChI=1S/C7H14O2.C6H12O3/c1-4-7(9-3)5-6(2)8;1-3-5(9-2)4-6(7)8/h7H,4-5H2,1-3H3;5H,3-4H2,1-2H3,(H,7,8) |
| InChIKey | AQSPXVPBWTWOOD-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-methoxyhexan-2-one;3-methoxypentanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxyhexan-2-one;3-methoxypentanoic acid?
The IUPAC name of 4-methoxyhexan-2-one;3-methoxypentanoic acid (CID 157200389) is 4-methoxyhexan-2-one;3-methoxypentanoic acid.
What is the SMILES notation for 4-methoxyhexan-2-one;3-methoxypentanoic acid?
The canonical SMILES for 4-methoxyhexan-2-one;3-methoxypentanoic acid is CCC(CC(=O)O)OC.CCC(CC(C)=O)OC.
What is the InChIKey of 4-methoxyhexan-2-one;3-methoxypentanoic acid?
The InChIKey is AQSPXVPBWTWOOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14O2.C6H12O3/c1-4-7(9-3)5-6(2)8;1-3-5(9-2)4-6(7)8/h7H,4-5H2,1-3H3;5H,3-4H2,1-2H3,(H,7,8).
What are the key properties of 4-methoxyhexan-2-one;3-methoxypentanoic acid?
4-methoxyhexan-2-one;3-methoxypentanoic acid has a molecular weight of 262.35 g/mol, XLogP of 2.28, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxyhexan-2-one;3-methoxypentanoic acid is sourced from PubChem (CID 157200389), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).