C13H25N3O5 — CID 103159154
4-[[3-(butan-2-ylamino)-3-oxopropyl]carbamoylamino]-3-methoxybutanoic acid (PubChem CID 103159154) has the molecular formula C13H25N3O5 and a molecular weight of 303.36 g/mol. Its IUPAC name is 4-[[3-(butan-2-ylamino)-3-oxopropyl]carbamoylamino]-3-methoxybutanoic acid.
| Compound Name | 4-[[3-(butan-2-ylamino)-3-oxopropyl]carbamoylamino]-3-methoxybutanoic acid |
|---|---|
| PubChem CID | 103159154 |
| Molecular Formula | C13H25N3O5 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.18 |
| IUPAC Name | 4-[[3-(butan-2-ylamino)-3-oxopropyl]carbamoylamino]-3-methoxybutanoic acid |
| SMILES | CCC(C)NC(=O)CCNC(=O)NCC(CC(=O)O)OC |
| InChI | InChI=1S/C13H25N3O5/c1-4-9(2)16-11(17)5-6-14-13(20)15-8-10(21-3)7-12(18)19/h9-10H,4-8H2,1-3H3,(H,16,17)(H,18,19)(H2,14,15,20) |
| InChIKey | ADKMHWRTMIRQCK-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 116.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |