C13H26N2O5 — CID 106004522
3-methoxy-4-(4-propan-2-yloxybutylcarbamoylamino)butanoic acid (PubChem CID 106004522) has the molecular formula C13H26N2O5 and a molecular weight of 290.36 g/mol. Its IUPAC name is 3-methoxy-4-(4-propan-2-yloxybutylcarbamoylamino)butanoic acid.
| Compound Name | 3-methoxy-4-(4-propan-2-yloxybutylcarbamoylamino)butanoic acid |
|---|---|
| PubChem CID | 106004522 |
| Molecular Formula | C13H26N2O5 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.18 |
| IUPAC Name | 3-methoxy-4-(4-propan-2-yloxybutylcarbamoylamino)butanoic acid |
| SMILES | COC(CNC(=O)NCCCCOC(C)C)CC(=O)O |
| InChI | InChI=1S/C13H26N2O5/c1-10(2)20-7-5-4-6-14-13(18)15-9-11(19-3)8-12(16)17/h10-11H,4-9H2,1-3H3,(H,16,17)(H2,14,15,18) |
| InChIKey | AUIZWPRURHTOEK-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|