C12H21NO3 — CID 103159405
1-[(3-cyclopentyl-2-hydroxypropyl)amino]cyclopropane-1-carboxylic acid (PubChem CID 103159405) has the molecular formula C12H21NO3 and a molecular weight of 227.30 g/mol. Its IUPAC name is 1-[(3-cyclopentyl-2-hydroxypropyl)amino]cyclopropane-1-carboxylic acid.
| Compound Name | 1-[(3-cyclopentyl-2-hydroxypropyl)amino]cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 103159405 |
| Molecular Formula | C12H21NO3 |
| Molecular Weight | 227.30 g/mol |
| Exact Mass | 227.15 |
| IUPAC Name | 1-[(3-cyclopentyl-2-hydroxypropyl)amino]cyclopropane-1-carboxylic acid |
| SMILES | O=C(O)C1(NCC(O)CC2CCCC2)CC1 |
| InChI | InChI=1S/C12H21NO3/c14-10(7-9-3-1-2-4-9)8-13-12(5-6-12)11(15)16/h9-10,13-14H,1-8H2,(H,15,16) |
| InChIKey | KJUASPWIHWCZTR-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.30 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |