C17H23F2NO — CID 103161246
2-(cyclopentylmethyl)-6-[3-(difluoromethyl)phenyl]morpholine (PubChem CID 103161246) has the molecular formula C17H23F2NO and a molecular weight of 295.37 g/mol. Its IUPAC name is 2-(cyclopentylmethyl)-6-[3-(difluoromethyl)phenyl]morpholine.
| Compound Name | 2-(cyclopentylmethyl)-6-[3-(difluoromethyl)phenyl]morpholine |
|---|---|
| PubChem CID | 103161246 |
| Molecular Formula | C17H23F2NO |
| Molecular Weight | 295.37 g/mol |
| Exact Mass | 295.17 |
| IUPAC Name | 2-(cyclopentylmethyl)-6-[3-(difluoromethyl)phenyl]morpholine |
| SMILES | FC(F)c1cccc(C2CNCC(CC3CCCC3)O2)c1 |
| InChI | InChI=1S/C17H23F2NO/c18-17(19)14-7-3-6-13(9-14)16-11-20-10-15(21-16)8-12-4-1-2-5-12/h3,6-7,9,12,15-17,20H,1-2,4-5,8,10-11H2 |
| InChIKey | FRELMCXNUMAXME-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.37 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |