C16H22N2O — CID 107155080
3-[6-(2,2-dimethylpropyl)morpholin-2-yl]benzonitrile (PubChem CID 107155080) has the molecular formula C16H22N2O and a molecular weight of 258.37 g/mol. Its IUPAC name is 3-[6-(2,2-dimethylpropyl)morpholin-2-yl]benzonitrile.
| Compound Name | 3-[6-(2,2-dimethylpropyl)morpholin-2-yl]benzonitrile |
|---|---|
| PubChem CID | 107155080 |
| Molecular Formula | C16H22N2O |
| Molecular Weight | 258.37 g/mol |
| Exact Mass | 258.17 |
| IUPAC Name | 3-[6-(2,2-dimethylpropyl)morpholin-2-yl]benzonitrile |
| SMILES | CC(C)(C)CC1CNCC(c2cccc(C#N)c2)O1 |
| InChI | InChI=1S/C16H22N2O/c1-16(2,3)8-14-10-18-11-15(19-14)13-6-4-5-12(7-13)9-17/h4-7,14-15,18H,8,10-11H2,1-3H3 |
| InChIKey | UBLKMEOKFYEGQE-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.37 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |