C15H21F2NO — CID 107155067
2-(2,6-difluorophenyl)-6-(2,2-dimethylpropyl)morpholine (PubChem CID 107155067) has the molecular formula C15H21F2NO and a molecular weight of 269.33 g/mol. Its IUPAC name is 2-(2,6-difluorophenyl)-6-(2,2-dimethylpropyl)morpholine.
| Compound Name | 2-(2,6-difluorophenyl)-6-(2,2-dimethylpropyl)morpholine |
|---|---|
| PubChem CID | 107155067 |
| Molecular Formula | C15H21F2NO |
| Molecular Weight | 269.33 g/mol |
| Exact Mass | 269.16 |
| IUPAC Name | 2-(2,6-difluorophenyl)-6-(2,2-dimethylpropyl)morpholine |
| SMILES | CC(C)(C)CC1CNCC(c2c(F)cccc2F)O1 |
| InChI | InChI=1S/C15H21F2NO/c1-15(2,3)7-10-8-18-9-13(19-10)14-11(16)5-4-6-12(14)17/h4-6,10,13,18H,7-9H2,1-3H3 |
| InChIKey | ALYQARIRUMACCP-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.33 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |