C15H21ClFNO — CID 107155036
2-(3-chloro-4-fluorophenyl)-6-(2,2-dimethylpropyl)morpholine (PubChem CID 107155036) has the molecular formula C15H21ClFNO and a molecular weight of 285.79 g/mol. Its IUPAC name is 2-(3-chloro-4-fluorophenyl)-6-(2,2-dimethylpropyl)morpholine.
| Compound Name | 2-(3-chloro-4-fluorophenyl)-6-(2,2-dimethylpropyl)morpholine |
|---|---|
| PubChem CID | 107155036 |
| Molecular Formula | C15H21ClFNO |
| Molecular Weight | 285.79 g/mol |
| Exact Mass | 285.13 |
| IUPAC Name | 2-(3-chloro-4-fluorophenyl)-6-(2,2-dimethylpropyl)morpholine |
| SMILES | CC(C)(C)CC1CNCC(c2ccc(F)c(Cl)c2)O1 |
| InChI | InChI=1S/C15H21ClFNO/c1-15(2,3)7-11-8-18-9-14(19-11)10-4-5-13(17)12(16)6-10/h4-6,11,14,18H,7-9H2,1-3H3 |
| InChIKey | MIOAGTHXOAHPDN-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.79 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |