C11H13ClFNO — CID 43498384
2-(3-chloro-4-fluorophenyl)-1,4-oxazepane (PubChem CID 43498384) has the molecular formula C11H13ClFNO and a molecular weight of 229.68 g/mol. Its IUPAC name is 2-(3-chloro-4-fluorophenyl)-1,4-oxazepane.
| Compound Name | 2-(3-chloro-4-fluorophenyl)-1,4-oxazepane |
|---|---|
| PubChem CID | 43498384 |
| Molecular Formula | C11H13ClFNO |
| Molecular Weight | 229.68 g/mol |
| Exact Mass | 229.07 |
| IUPAC Name | 2-(3-chloro-4-fluorophenyl)-1,4-oxazepane |
| SMILES | Fc1ccc(C2CNCCCO2)cc1Cl |
| InChI | InChI=1S/C11H13ClFNO/c12-9-6-8(2-3-10(9)13)11-7-14-4-1-5-15-11/h2-3,6,11,14H,1,4-5,7H2 |
| InChIKey | DREVXMCFTYJVKP-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.68 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |