About [7-(3-chloro-4-fluorophenyl)-1,4-oxazepan-6-yl]methanol;hydrochloride
[7-(3-chloro-4-fluorophenyl)-1,4-oxazepan-6-yl]methanol;hydrochloride (PubChem CID 66976642) has the molecular formula C12H16Cl2FNO2
and a molecular weight of 296.17 g/mol. Its IUPAC name is [7-(3-chloro-4-fluorophenyl)-1,4-oxazepan-6-yl]methanol;hydrochloride.
Molecular Properties
| Compound Name | [7-(3-chloro-4-fluorophenyl)-1,4-oxazepan-6-yl]methanol;hydrochloride |
| PubChem CID | 66976642 |
| Molecular Formula | C12H16Cl2FNO2 |
| Molecular Weight | 296.17 g/mol |
| Exact Mass | 295.05 |
| IUPAC Name | [7-(3-chloro-4-fluorophenyl)-1,4-oxazepan-6-yl]methanol;hydrochloride |
| SMILES | Cl.OCC1CNCCOC1c1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C12H15ClFNO2.ClH/c13-10-5-8(1-2-11(10)14)12-9(7-16)6-15-3-4-17-12;/h1-2,5,9,12,15-16H,3-4,6-7H2;1H |
| InChIKey | RIKYXLKNXUHQTH-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.17 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [7-(3-chloro-4-fluorophenyl)-1,4-oxazepan-6-yl]methanol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [7-(3-chloro-4-fluorophenyl)-1,4-oxazepan-6-yl]methanol;hydrochloride?
The IUPAC name of [7-(3-chloro-4-fluorophenyl)-1,4-oxazepan-6-yl]methanol;hydrochloride (CID 66976642) is [7-(3-chloro-4-fluorophenyl)-1,4-oxazepan-6-yl]methanol;hydrochloride.
What is the SMILES notation for [7-(3-chloro-4-fluorophenyl)-1,4-oxazepan-6-yl]methanol;hydrochloride?
The canonical SMILES for [7-(3-chloro-4-fluorophenyl)-1,4-oxazepan-6-yl]methanol;hydrochloride is Cl.OCC1CNCCOC1c1ccc(F)c(Cl)c1.
What is the InChIKey of [7-(3-chloro-4-fluorophenyl)-1,4-oxazepan-6-yl]methanol;hydrochloride?
The InChIKey is RIKYXLKNXUHQTH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15ClFNO2.ClH/c13-10-5-8(1-2-11(10)14)12-9(7-16)6-15-3-4-17-12;/h1-2,5,9,12,15-16H,3-4,6-7H2;1H.
What are the key properties of [7-(3-chloro-4-fluorophenyl)-1,4-oxazepan-6-yl]methanol;hydrochloride?
[7-(3-chloro-4-fluorophenyl)-1,4-oxazepan-6-yl]methanol;hydrochloride has a molecular weight of 296.17 g/mol, XLogP of 2.17, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [7-(3-chloro-4-fluorophenyl)-1,4-oxazepan-6-yl]methanol;hydrochloride is sourced from PubChem (CID 66976642), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).