C21H22N2O2 — CID 50960702
N-[(2S,4R,6S)-2-(3-cyanophenyl)-6-ethyloxan-4-yl]benzamide (PubChem CID 50960702) has the molecular formula C21H22N2O2 and a molecular weight of 334.42 g/mol. Its IUPAC name is N-[(2S,4R,6S)-2-(3-cyanophenyl)-6-ethyloxan-4-yl]benzamide.
| Compound Name | N-[(2S,4R,6S)-2-(3-cyanophenyl)-6-ethyloxan-4-yl]benzamide |
|---|---|
| PubChem CID | 50960702 |
| Molecular Formula | C21H22N2O2 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.17 |
| IUPAC Name | N-[(2S,4R,6S)-2-(3-cyanophenyl)-6-ethyloxan-4-yl]benzamide |
| SMILES | CC[C@H]1C[C@@H](NC(=O)c2ccccc2)C[C@@H](c2cccc(C#N)c2)O1 |
| InChI | InChI=1S/C21H22N2O2/c1-2-19-12-18(23-21(24)16-8-4-3-5-9-16)13-20(25-19)17-10-6-7-15(11-17)14-22/h3-11,18-20H,2,12-13H2,1H3,(H,23,24)/t18-,19+,20+/m1/s1 |
| InChIKey | QHIXZCBFQPUHFW-AABGKKOBSA-N |
| XLogP | 3.99 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |