C21H25N3O4 — CID 174900584
tert-butyl N-[[5-(3-cyanophenyl)-2-morpholin-2-ylfuran-3-yl]methyl]carbamate (PubChem CID 174900584) has the molecular formula C21H25N3O4 and a molecular weight of 383.45 g/mol. Its IUPAC name is tert-butyl N-[[5-(3-cyanophenyl)-2-morpholin-2-ylfuran-3-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[5-(3-cyanophenyl)-2-morpholin-2-ylfuran-3-yl]methyl]carbamate |
|---|---|
| PubChem CID | 174900584 |
| Molecular Formula | C21H25N3O4 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.18 |
| IUPAC Name | tert-butyl N-[[5-(3-cyanophenyl)-2-morpholin-2-ylfuran-3-yl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCc1cc(-c2cccc(C#N)c2)oc1C1CNCCO1 |
| InChI | InChI=1S/C21H25N3O4/c1-21(2,3)28-20(25)24-12-16-10-17(15-6-4-5-14(9-15)11-22)27-19(16)18-13-23-7-8-26-18/h4-6,9-10,18,23H,7-8,12-13H2,1-3H3,(H,24,25) |
| InChIKey | IUIWPRSYDUEUGI-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 96.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |