C15H18ClN3O5 — CID 10316197
(1Z)-N-[(4-chlorophenyl)methoxy]-1-(3-methyl-2,4-dihydropyrimidin-5-ylidene)methanamine;oxalic acid (PubChem CID 10316197) has the molecular formula C15H18ClN3O5 and a molecular weight of 355.78 g/mol. Its IUPAC name is (1Z)-N-[(4-chlorophenyl)methoxy]-1-(3-methyl-2,4-dihydropyrimidin-5-ylidene)methanamine;oxalic acid.
| Compound Name | (1Z)-N-[(4-chlorophenyl)methoxy]-1-(3-methyl-2,4-dihydropyrimidin-5-ylidene)methanamine;oxalic acid |
|---|---|
| PubChem CID | 10316197 |
| Molecular Formula | C15H18ClN3O5 |
| Molecular Weight | 355.78 g/mol |
| Exact Mass | 355.09 |
| IUPAC Name | (1Z)-N-[(4-chlorophenyl)methoxy]-1-(3-methyl-2,4-dihydropyrimidin-5-ylidene)methanamine;oxalic acid |
| SMILES | CN1CN=C/C(=C\NOCc2ccc(Cl)cc2)C1.O=C(O)C(=O)O |
| InChI | InChI=1S/C13H16ClN3O.C2H2O4/c1-17-8-12(6-15-10-17)7-16-18-9-11-2-4-13(14)5-3-11;3-1(4)2(5)6/h2-7,16H,8-10H2,1H3;(H,3,4)(H,5,6)/b12-7+; |
| InChIKey | RTHLXFHNELIENM-RRAJOLSVSA-N |
| XLogP | 1.37 |
| TPSA | 111.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.78 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|