C17H19ClO4 — CID 23103370
(E)-3-[1-[(4-chlorophenyl)methoxycarbonyl]-2,2-dimethylcyclopropyl]-2-methylprop-2-enoic acid (PubChem CID 23103370) has the molecular formula C17H19ClO4 and a molecular weight of 322.79 g/mol. Its IUPAC name is (E)-3-[1-[(4-chlorophenyl)methoxycarbonyl]-2,2-dimethylcyclopropyl]-2-methylprop-2-enoic acid.
| Compound Name | (E)-3-[1-[(4-chlorophenyl)methoxycarbonyl]-2,2-dimethylcyclopropyl]-2-methylprop-2-enoic acid |
|---|---|
| PubChem CID | 23103370 |
| Molecular Formula | C17H19ClO4 |
| Molecular Weight | 322.79 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | (E)-3-[1-[(4-chlorophenyl)methoxycarbonyl]-2,2-dimethylcyclopropyl]-2-methylprop-2-enoic acid |
| SMILES | C/C(=C\C1(C(=O)OCc2ccc(Cl)cc2)CC1(C)C)C(=O)O |
| InChI | InChI=1S/C17H19ClO4/c1-11(14(19)20)8-17(10-16(17,2)3)15(21)22-9-12-4-6-13(18)7-5-12/h4-8H,9-10H2,1-3H3,(H,19,20)/b11-8+ |
| InChIKey | IYRAZXSHSCFRPD-DHZHZOJOSA-N |
| XLogP | 3.83 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.79 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|