C10H12Br2O4 — CID 10316204
[(1S,4S,5R,6R)-4-acetyloxy-5,6-dibromocyclohex-2-en-1-yl] acetate (PubChem CID 10316204) has the molecular formula C10H12Br2O4 and a molecular weight of 356.01 g/mol. Its IUPAC name is [(1S,4S,5R,6R)-4-acetyloxy-5,6-dibromocyclohex-2-en-1-yl] acetate.
| Compound Name | [(1S,4S,5R,6R)-4-acetyloxy-5,6-dibromocyclohex-2-en-1-yl] acetate |
|---|---|
| PubChem CID | 10316204 |
| Molecular Formula | C10H12Br2O4 |
| Molecular Weight | 356.01 g/mol |
| Exact Mass | 353.91 |
| IUPAC Name | [(1S,4S,5R,6R)-4-acetyloxy-5,6-dibromocyclohex-2-en-1-yl] acetate |
| SMILES | CC(=O)O[C@H]1C=C[C@H](OC(C)=O)[C@@H](Br)[C@@H]1Br |
| InChI | InChI=1S/C10H12Br2O4/c1-5(13)15-7-3-4-8(16-6(2)14)10(12)9(7)11/h3-4,7-10H,1-2H3/t7-,8-,9+,10+/m0/s1 |
| InChIKey | AHADRVMTJFKHFW-AXTSPUMRSA-N |
| XLogP | 1.95 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.01 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|