C15H18BrNO4 — CID 103162083
3-bromo-5-[[2-(3-ethoxycyclobutyl)acetyl]amino]benzoic acid (PubChem CID 103162083) has the molecular formula C15H18BrNO4 and a molecular weight of 356.22 g/mol. Its IUPAC name is 3-bromo-5-[[2-(3-ethoxycyclobutyl)acetyl]amino]benzoic acid.
| Compound Name | 3-bromo-5-[[2-(3-ethoxycyclobutyl)acetyl]amino]benzoic acid |
|---|---|
| PubChem CID | 103162083 |
| Molecular Formula | C15H18BrNO4 |
| Molecular Weight | 356.22 g/mol |
| Exact Mass | 355.04 |
| IUPAC Name | 3-bromo-5-[[2-(3-ethoxycyclobutyl)acetyl]amino]benzoic acid |
| SMILES | CCOC1CC(CC(=O)Nc2cc(Br)cc(C(=O)O)c2)C1 |
| InChI | InChI=1S/C15H18BrNO4/c1-2-21-13-3-9(4-13)5-14(18)17-12-7-10(15(19)20)6-11(16)8-12/h6-9,13H,2-5H2,1H3,(H,17,18)(H,19,20) |
| InChIKey | LZOPTLSGLLIVEY-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.22 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |