C14H18N2O4 — CID 103161966
2-[[2-(3-ethoxycyclobutyl)acetyl]amino]pyridine-4-carboxylic acid (PubChem CID 103161966) has the molecular formula C14H18N2O4 and a molecular weight of 278.31 g/mol. Its IUPAC name is 2-[[2-(3-ethoxycyclobutyl)acetyl]amino]pyridine-4-carboxylic acid.
| Compound Name | 2-[[2-(3-ethoxycyclobutyl)acetyl]amino]pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 103161966 |
| Molecular Formula | C14H18N2O4 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | 2-[[2-(3-ethoxycyclobutyl)acetyl]amino]pyridine-4-carboxylic acid |
| SMILES | CCOC1CC(CC(=O)Nc2cc(C(=O)O)ccn2)C1 |
| InChI | InChI=1S/C14H18N2O4/c1-2-20-11-5-9(6-11)7-13(17)16-12-8-10(14(18)19)3-4-15-12/h3-4,8-9,11H,2,5-7H2,1H3,(H,18,19)(H,15,16,17) |
| InChIKey | DHAHRIAWRNOQLF-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |