C14H17Cl2NO3 — CID 103279698
N-(3,5-dichloro-2-hydroxyphenyl)-2-(3-ethoxycyclobutyl)acetamide (PubChem CID 103279698) has the molecular formula C14H17Cl2NO3 and a molecular weight of 318.20 g/mol. Its IUPAC name is N-(3,5-dichloro-2-hydroxyphenyl)-2-(3-ethoxycyclobutyl)acetamide.
| Compound Name | N-(3,5-dichloro-2-hydroxyphenyl)-2-(3-ethoxycyclobutyl)acetamide |
|---|---|
| PubChem CID | 103279698 |
| Molecular Formula | C14H17Cl2NO3 |
| Molecular Weight | 318.20 g/mol |
| Exact Mass | 317.06 |
| IUPAC Name | N-(3,5-dichloro-2-hydroxyphenyl)-2-(3-ethoxycyclobutyl)acetamide |
| SMILES | CCOC1CC(CC(=O)Nc2cc(Cl)cc(Cl)c2O)C1 |
| InChI | InChI=1S/C14H17Cl2NO3/c1-2-20-10-3-8(4-10)5-13(18)17-12-7-9(15)6-11(16)14(12)19/h6-8,10,19H,2-5H2,1H3,(H,17,18) |
| InChIKey | VCLNFFCAVSBXFV-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.20 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|