C16H19NO3 — CID 103163888
4-cyclobutyl-2-(3,4-dimethoxyphenyl)-3-oxobutanenitrile (PubChem CID 103163888) has the molecular formula C16H19NO3 and a molecular weight of 273.33 g/mol. Its IUPAC name is 4-cyclobutyl-2-(3,4-dimethoxyphenyl)-3-oxobutanenitrile.
| Compound Name | 4-cyclobutyl-2-(3,4-dimethoxyphenyl)-3-oxobutanenitrile |
|---|---|
| PubChem CID | 103163888 |
| Molecular Formula | C16H19NO3 |
| Molecular Weight | 273.33 g/mol |
| Exact Mass | 273.14 |
| IUPAC Name | 4-cyclobutyl-2-(3,4-dimethoxyphenyl)-3-oxobutanenitrile |
| SMILES | COc1ccc(C(C#N)C(=O)CC2CCC2)cc1OC |
| InChI | InChI=1S/C16H19NO3/c1-19-15-7-6-12(9-16(15)20-2)13(10-17)14(18)8-11-4-3-5-11/h6-7,9,11,13H,3-5,8H2,1-2H3 |
| InChIKey | ZMTUFFUKAVLRLJ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.33 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |