C14H13ClFNO — CID 103163928
2-(2-chloro-4-fluorophenyl)-4-cyclobutyl-3-oxobutanenitrile (PubChem CID 103163928) has the molecular formula C14H13ClFNO and a molecular weight of 265.71 g/mol. Its IUPAC name is 2-(2-chloro-4-fluorophenyl)-4-cyclobutyl-3-oxobutanenitrile.
| Compound Name | 2-(2-chloro-4-fluorophenyl)-4-cyclobutyl-3-oxobutanenitrile |
|---|---|
| PubChem CID | 103163928 |
| Molecular Formula | C14H13ClFNO |
| Molecular Weight | 265.71 g/mol |
| Exact Mass | 265.07 |
| IUPAC Name | 2-(2-chloro-4-fluorophenyl)-4-cyclobutyl-3-oxobutanenitrile |
| SMILES | N#CC(C(=O)CC1CCC1)c1ccc(F)cc1Cl |
| InChI | InChI=1S/C14H13ClFNO/c15-13-7-10(16)4-5-11(13)12(8-17)14(18)6-9-2-1-3-9/h4-5,7,9,12H,1-3,6H2 |
| InChIKey | GKNVZXKILWNDOW-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.71 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |