About 2-nitrooxypropyl (2E)-3-oxo-2-[[3-(trifluoromethyl)phenyl]methylidene]butanoate
2-nitrooxypropyl (2E)-3-oxo-2-[[3-(trifluoromethyl)phenyl]methylidene]butanoate (PubChem CID 10316515) has the molecular formula C15H14F3NO6
and a molecular weight of 361.27 g/mol. Its IUPAC name is 2-nitrooxypropyl (2E)-3-oxo-2-[[3-(trifluoromethyl)phenyl]methylidene]butanoate.
Molecular Properties
| Compound Name | 2-nitrooxypropyl (2E)-3-oxo-2-[[3-(trifluoromethyl)phenyl]methylidene]butanoate |
| PubChem CID | 10316515 |
| Molecular Formula | C15H14F3NO6 |
| Molecular Weight | 361.27 g/mol |
| Exact Mass | 361.08 |
| IUPAC Name | 2-nitrooxypropyl (2E)-3-oxo-2-[[3-(trifluoromethyl)phenyl]methylidene]butanoate |
| SMILES | CC(=O)/C(=C\c1cccc(C(F)(F)F)c1)C(=O)OCC(C)O[N+](=O)[O-] |
| InChI | InChI=1S/C15H14F3NO6/c1-9(25-19(22)23)8-24-14(21)13(10(2)20)7-11-4-3-5-12(6-11)15(16,17)18/h3-7,9H,8H2,1-2H3/b13-7+ |
| InChIKey | KWKZMBJQNHAEJX-NTUHNPAUSA-N |
| XLogP | 2.82 |
| TPSA | 95.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.27 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-nitrooxypropyl (2E)-3-oxo-2-[[3-(trifluoromethyl)phenyl]methylidene]butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-nitrooxypropyl (2E)-3-oxo-2-[[3-(trifluoromethyl)phenyl]methylidene]butanoate?
The IUPAC name of 2-nitrooxypropyl (2E)-3-oxo-2-[[3-(trifluoromethyl)phenyl]methylidene]butanoate (CID 10316515) is 2-nitrooxypropyl (2E)-3-oxo-2-[[3-(trifluoromethyl)phenyl]methylidene]butanoate.
What is the SMILES notation for 2-nitrooxypropyl (2E)-3-oxo-2-[[3-(trifluoromethyl)phenyl]methylidene]butanoate?
The canonical SMILES for 2-nitrooxypropyl (2E)-3-oxo-2-[[3-(trifluoromethyl)phenyl]methylidene]butanoate is CC(=O)/C(=C\c1cccc(C(F)(F)F)c1)C(=O)OCC(C)O[N+](=O)[O-].
What is the InChIKey of 2-nitrooxypropyl (2E)-3-oxo-2-[[3-(trifluoromethyl)phenyl]methylidene]butanoate?
The InChIKey is KWKZMBJQNHAEJX-NTUHNPAUSA-N. The full InChI is InChI=1S/C15H14F3NO6/c1-9(25-19(22)23)8-24-14(21)13(10(2)20)7-11-4-3-5-12(6-11)15(16,17)18/h3-7,9H,8H2,1-2H3/b13-7+.
What are the key properties of 2-nitrooxypropyl (2E)-3-oxo-2-[[3-(trifluoromethyl)phenyl]methylidene]butanoate?
2-nitrooxypropyl (2E)-3-oxo-2-[[3-(trifluoromethyl)phenyl]methylidene]butanoate has a molecular weight of 361.27 g/mol, XLogP of 2.82, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-nitrooxypropyl (2E)-3-oxo-2-[[3-(trifluoromethyl)phenyl]methylidene]butanoate is sourced from PubChem (CID 10316515), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).