C14H16F3NO4 — CID 159249644
1-(3,3-diethoxy-2-nitroprop-1-enyl)-3-(trifluoromethyl)benzene (PubChem CID 159249644) has the molecular formula C14H16F3NO4 and a molecular weight of 319.28 g/mol. Its IUPAC name is 1-(3,3-diethoxy-2-nitroprop-1-enyl)-3-(trifluoromethyl)benzene.
| Compound Name | 1-(3,3-diethoxy-2-nitroprop-1-enyl)-3-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 159249644 |
| Molecular Formula | C14H16F3NO4 |
| Molecular Weight | 319.28 g/mol |
| Exact Mass | 319.10 |
| IUPAC Name | 1-(3,3-diethoxy-2-nitroprop-1-enyl)-3-(trifluoromethyl)benzene |
| SMILES | CCOC(OCC)C(=Cc1cccc(C(F)(F)F)c1)[N+](=O)[O-] |
| InChI | InChI=1S/C14H16F3NO4/c1-3-21-13(22-4-2)12(18(19)20)9-10-6-5-7-11(8-10)14(15,16)17/h5-9,13H,3-4H2,1-2H3 |
| InChIKey | KVCWFPDFSDTZHT-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 61.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.28 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|