C19H23BrO2 — CID 10316623
(1R,2S,3S,11S,12S,16S)-2-bromo-16-methylpentacyclo[9.7.0.01,3.03,8.012,16]octadec-7-ene-6,15-dione (PubChem CID 10316623) has the molecular formula C19H23BrO2 and a molecular weight of 363.30 g/mol. Its IUPAC name is (1R,2S,3S,11S,12S,16S)-2-bromo-16-methylpentacyclo[9.7.0.01,3.03,8.012,16]octadec-7-ene-6,15-dione.
| Compound Name | (1R,2S,3S,11S,12S,16S)-2-bromo-16-methylpentacyclo[9.7.0.01,3.03,8.012,16]octadec-7-ene-6,15-dione |
|---|---|
| PubChem CID | 10316623 |
| Molecular Formula | C19H23BrO2 |
| Molecular Weight | 363.30 g/mol |
| Exact Mass | 362.09 |
| IUPAC Name | (1R,2S,3S,11S,12S,16S)-2-bromo-16-methylpentacyclo[9.7.0.01,3.03,8.012,16]octadec-7-ene-6,15-dione |
| SMILES | C[C@]12CC[C@@]34[C@@H](CCC5=CC(=O)CC[C@]53[C@H]4Br)[C@@H]1CCC2=O |
| InChI | InChI=1S/C19H23BrO2/c1-17-8-9-19-14(13(17)4-5-15(17)22)3-2-11-10-12(21)6-7-18(11,19)16(19)20/h10,13-14,16H,2-9H2,1H3/t13-,14-,16+,17-,18+,19-/m0/s1 |
| InChIKey | JVOCJSLBGMEGCU-PPVURNQTSA-N |
| XLogP | 4.21 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.30 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|