C21H28O4 — CID 54003853
[(8S,9R,10S,13S,14S)-10,13-dimethyl-3,17-dioxo-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-9-yl] acetate (PubChem CID 54003853) has the molecular formula C21H28O4 and a molecular weight of 344.45 g/mol. Its IUPAC name is [(8S,9R,10S,13S,14S)-10,13-dimethyl-3,17-dioxo-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-9-yl] acetate.
| Compound Name | [(8S,9R,10S,13S,14S)-10,13-dimethyl-3,17-dioxo-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-9-yl] acetate |
|---|---|
| PubChem CID | 54003853 |
| Molecular Formula | C21H28O4 |
| Molecular Weight | 344.45 g/mol |
| Exact Mass | 344.20 |
| IUPAC Name | [(8S,9R,10S,13S,14S)-10,13-dimethyl-3,17-dioxo-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-9-yl] acetate |
| SMILES | CC(=O)O[C@]12CC[C@]3(C)C(=O)CC[C@H]3[C@@H]1CCC1=CC(=O)CC[C@@]12C |
| InChI | InChI=1S/C21H28O4/c1-13(22)25-21-11-10-19(2)16(6-7-18(19)24)17(21)5-4-14-12-15(23)8-9-20(14,21)3/h12,16-17H,4-11H2,1-3H3/t16-,17-,19-,20-,21+/m0/s1 |
| InChIKey | KNLWBXZVYTYDAG-JZTRKIHISA-N |
| XLogP | 3.77 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.45 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |