C23H30Cl2O4 — CID 125031121
[(8S,9R,10S,11S,13R,14R,17R)-17-acetyl-9,11-dichloro-10,13-dimethyl-3-oxo-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-yl] acetate (PubChem CID 125031121) has the molecular formula C23H30Cl2O4 and a molecular weight of 441.40 g/mol. Its IUPAC name is [(8S,9R,10S,11S,13R,14R,17R)-17-acetyl-9,11-dichloro-10,13-dimethyl-3-oxo-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-yl] acetate.
| Compound Name | [(8S,9R,10S,11S,13R,14R,17R)-17-acetyl-9,11-dichloro-10,13-dimethyl-3-oxo-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-yl] acetate |
|---|---|
| PubChem CID | 125031121 |
| Molecular Formula | C23H30Cl2O4 |
| Molecular Weight | 441.40 g/mol |
| Exact Mass | 440.15 |
| IUPAC Name | [(8S,9R,10S,11S,13R,14R,17R)-17-acetyl-9,11-dichloro-10,13-dimethyl-3-oxo-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-yl] acetate |
| SMILES | CC(=O)O[C@]1(C(C)=O)CC[C@@H]2[C@@H]3CCC4=CC(=O)CC[C@]4(C)[C@@]3(Cl)[C@@H](Cl)C[C@]21C |
| InChI | InChI=1S/C23H30Cl2O4/c1-13(26)22(29-14(2)27)10-8-17-18-6-5-15-11-16(28)7-9-20(15,3)23(18,25)19(24)12-21(17,22)4/h11,17-19H,5-10,12H2,1-4H3/t17-,18+,19+,20+,21-,22+,23+/m1/s1 |
| InChIKey | LULGNBXHOOJRRU-XWRAWWFBSA-N |
| XLogP | 4.99 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.40 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|