C23H31FO4 — CID 70626161
[(8S,9S,10R,13S,14S,17R)-17-acetyl-11-fluoro-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl] acetate (PubChem CID 70626161) has the molecular formula C23H31FO4 and a molecular weight of 390.50 g/mol. Its IUPAC name is [(8S,9S,10R,13S,14S,17R)-17-acetyl-11-fluoro-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl] acetate.
| Compound Name | [(8S,9S,10R,13S,14S,17R)-17-acetyl-11-fluoro-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl] acetate |
|---|---|
| PubChem CID | 70626161 |
| Molecular Formula | C23H31FO4 |
| Molecular Weight | 390.50 g/mol |
| Exact Mass | 390.22 |
| IUPAC Name | [(8S,9S,10R,13S,14S,17R)-17-acetyl-11-fluoro-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl] acetate |
| SMILES | CC(=O)O[C@]1(C(C)=O)CC[C@H]2[C@@H]3CCC4=CC(=O)CC[C@]4(C)[C@H]3C(F)C[C@@]21C |
| InChI | InChI=1S/C23H31FO4/c1-13(25)23(28-14(2)26)10-8-18-17-6-5-15-11-16(27)7-9-21(15,3)20(17)19(24)12-22(18,23)4/h11,17-20H,5-10,12H2,1-4H3/t17-,18-,19?,20+,21-,22-,23-/m0/s1 |
| InChIKey | OLCMVXQLZBPVKS-WZTJLWJCSA-N |
| XLogP | 4.36 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.50 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |