C9H15N3OS — CID 103167080
5-[(3-ethoxycyclobutyl)methyl]-1,2,4-thiadiazol-3-amine (PubChem CID 103167080) has the molecular formula C9H15N3OS and a molecular weight of 213.31 g/mol. Its IUPAC name is 5-[(3-ethoxycyclobutyl)methyl]-1,2,4-thiadiazol-3-amine.
| Compound Name | 5-[(3-ethoxycyclobutyl)methyl]-1,2,4-thiadiazol-3-amine |
|---|---|
| PubChem CID | 103167080 |
| Molecular Formula | C9H15N3OS |
| Molecular Weight | 213.31 g/mol |
| Exact Mass | 213.09 |
| IUPAC Name | 5-[(3-ethoxycyclobutyl)methyl]-1,2,4-thiadiazol-3-amine |
| SMILES | CCOC1CC(Cc2nc(N)ns2)C1 |
| InChI | InChI=1S/C9H15N3OS/c1-2-13-7-3-6(4-7)5-8-11-9(10)12-14-8/h6-7H,2-5H2,1H3,(H2,10,12) |
| InChIKey | ZVBATYRHVFWYLC-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.31 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |