C16H28ClN3O — CID 103168933
1-(4-chloro-3-ethyl-1-methylpyrazol-5-yl)-3-(3-ethoxycyclobutyl)-N-methylpropan-2-amine (PubChem CID 103168933) has the molecular formula C16H28ClN3O and a molecular weight of 313.87 g/mol. Its IUPAC name is 1-(4-chloro-3-ethyl-1-methylpyrazol-5-yl)-3-(3-ethoxycyclobutyl)-N-methylpropan-2-amine.
| Compound Name | 1-(4-chloro-3-ethyl-1-methylpyrazol-5-yl)-3-(3-ethoxycyclobutyl)-N-methylpropan-2-amine |
|---|---|
| PubChem CID | 103168933 |
| Molecular Formula | C16H28ClN3O |
| Molecular Weight | 313.87 g/mol |
| Exact Mass | 313.19 |
| IUPAC Name | 1-(4-chloro-3-ethyl-1-methylpyrazol-5-yl)-3-(3-ethoxycyclobutyl)-N-methylpropan-2-amine |
| SMILES | CCOC1CC(CC(Cc2c(Cl)c(CC)nn2C)NC)C1 |
| InChI | InChI=1S/C16H28ClN3O/c1-5-14-16(17)15(20(4)19-14)10-12(18-3)7-11-8-13(9-11)21-6-2/h11-13,18H,5-10H2,1-4H3 |
| InChIKey | GCEXBSJPIONLSG-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.87 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |