C15H28ClN3 — CID 104998438
1-(4-chloro-3-ethyl-1-methylpyrazol-5-yl)-N-ethyl-4-methylhexan-2-amine (PubChem CID 104998438) has the molecular formula C15H28ClN3 and a molecular weight of 285.86 g/mol. Its IUPAC name is 1-(4-chloro-3-ethyl-1-methylpyrazol-5-yl)-N-ethyl-4-methylhexan-2-amine.
| Compound Name | 1-(4-chloro-3-ethyl-1-methylpyrazol-5-yl)-N-ethyl-4-methylhexan-2-amine |
|---|---|
| PubChem CID | 104998438 |
| Molecular Formula | C15H28ClN3 |
| Molecular Weight | 285.86 g/mol |
| Exact Mass | 285.20 |
| IUPAC Name | 1-(4-chloro-3-ethyl-1-methylpyrazol-5-yl)-N-ethyl-4-methylhexan-2-amine |
| SMILES | CCNC(Cc1c(Cl)c(CC)nn1C)CC(C)CC |
| InChI | InChI=1S/C15H28ClN3/c1-6-11(4)9-12(17-8-3)10-14-15(16)13(7-2)18-19(14)5/h11-12,17H,6-10H2,1-5H3 |
| InChIKey | ZCQOMZVVOMITDW-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.86 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |