C16H30BrN3 — CID 104994586
1-(4-bromo-3-ethyl-1-methylpyrazol-5-yl)-4-methyl-N-propylhexan-2-amine (PubChem CID 104994586) has the molecular formula C16H30BrN3 and a molecular weight of 344.34 g/mol. Its IUPAC name is 1-(4-bromo-3-ethyl-1-methylpyrazol-5-yl)-4-methyl-N-propylhexan-2-amine.
| Compound Name | 1-(4-bromo-3-ethyl-1-methylpyrazol-5-yl)-4-methyl-N-propylhexan-2-amine |
|---|---|
| PubChem CID | 104994586 |
| Molecular Formula | C16H30BrN3 |
| Molecular Weight | 344.34 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | 1-(4-bromo-3-ethyl-1-methylpyrazol-5-yl)-4-methyl-N-propylhexan-2-amine |
| SMILES | CCCNC(Cc1c(Br)c(CC)nn1C)CC(C)CC |
| InChI | InChI=1S/C16H30BrN3/c1-6-9-18-13(10-12(4)7-2)11-15-16(17)14(8-3)19-20(15)5/h12-13,18H,6-11H2,1-5H3 |
| InChIKey | RMMDPTMIPBRQIE-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.34 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |