C12H20BrN3 — CID 116660678
1-(4-bromo-3-ethyl-1-methylpyrazol-5-yl)-N-methylpent-4-en-2-amine (PubChem CID 116660678) has the molecular formula C12H20BrN3 and a molecular weight of 286.22 g/mol. Its IUPAC name is 1-(4-bromo-3-ethyl-1-methylpyrazol-5-yl)-N-methylpent-4-en-2-amine.
| Compound Name | 1-(4-bromo-3-ethyl-1-methylpyrazol-5-yl)-N-methylpent-4-en-2-amine |
|---|---|
| PubChem CID | 116660678 |
| Molecular Formula | C12H20BrN3 |
| Molecular Weight | 286.22 g/mol |
| Exact Mass | 285.08 |
| IUPAC Name | 1-(4-bromo-3-ethyl-1-methylpyrazol-5-yl)-N-methylpent-4-en-2-amine |
| SMILES | C=CCC(Cc1c(Br)c(CC)nn1C)NC |
| InChI | InChI=1S/C12H20BrN3/c1-5-7-9(14-3)8-11-12(13)10(6-2)15-16(11)4/h5,9,14H,1,6-8H2,2-4H3 |
| InChIKey | SLPLIAMEAWDNEL-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.22 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|