C11H21N — CID 103169029
1-cyclobutyl-N,4-dimethylpent-4-en-2-amine (PubChem CID 103169029) has the molecular formula C11H21N and a molecular weight of 167.30 g/mol. Its IUPAC name is 1-cyclobutyl-N,4-dimethylpent-4-en-2-amine.
| Compound Name | 1-cyclobutyl-N,4-dimethylpent-4-en-2-amine |
|---|---|
| PubChem CID | 103169029 |
| Molecular Formula | C11H21N |
| Molecular Weight | 167.30 g/mol |
| Exact Mass | 167.17 |
| IUPAC Name | 1-cyclobutyl-N,4-dimethylpent-4-en-2-amine |
| SMILES | C=C(C)CC(CC1CCC1)NC |
| InChI | InChI=1S/C11H21N/c1-9(2)7-11(12-3)8-10-5-4-6-10/h10-12H,1,4-8H2,2-3H3 |
| InChIKey | IQWLAHOEQIMSAC-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.30 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|