About ethane;4-methyl-2-(methylamino)pent-4-en-1-ol
ethane;4-methyl-2-(methylamino)pent-4-en-1-ol (PubChem CID 142030684) has the molecular formula C11H27NO
and a molecular weight of 189.34 g/mol. Its IUPAC name is ethane;4-methyl-2-(methylamino)pent-4-en-1-ol.
Molecular Properties
| Compound Name | ethane;4-methyl-2-(methylamino)pent-4-en-1-ol |
| PubChem CID | 142030684 |
| Molecular Formula | C11H27NO |
| Molecular Weight | 189.34 g/mol |
| Exact Mass | 189.21 |
| IUPAC Name | ethane;4-methyl-2-(methylamino)pent-4-en-1-ol |
| SMILES | C=C(C)CC(CO)NC.CC.CC |
| InChI | InChI=1S/C7H15NO.2C2H6/c1-6(2)4-7(5-9)8-3;2*1-2/h7-9H,1,4-5H2,2-3H3;2*1-2H3 |
| InChIKey | CNXNMTAZBIVPTQ-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.34 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethane;4-methyl-2-(methylamino)pent-4-en-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;4-methyl-2-(methylamino)pent-4-en-1-ol?
The IUPAC name of ethane;4-methyl-2-(methylamino)pent-4-en-1-ol (CID 142030684) is ethane;4-methyl-2-(methylamino)pent-4-en-1-ol.
What is the SMILES notation for ethane;4-methyl-2-(methylamino)pent-4-en-1-ol?
The canonical SMILES for ethane;4-methyl-2-(methylamino)pent-4-en-1-ol is C=C(C)CC(CO)NC.CC.CC.
What is the InChIKey of ethane;4-methyl-2-(methylamino)pent-4-en-1-ol?
The InChIKey is CNXNMTAZBIVPTQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15NO.2C2H6/c1-6(2)4-7(5-9)8-3;2*1-2/h7-9H,1,4-5H2,2-3H3;2*1-2H3.
What are the key properties of ethane;4-methyl-2-(methylamino)pent-4-en-1-ol?
ethane;4-methyl-2-(methylamino)pent-4-en-1-ol has a molecular weight of 189.34 g/mol, XLogP of 2.59, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;4-methyl-2-(methylamino)pent-4-en-1-ol is sourced from PubChem (CID 142030684), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).