C15H24N2O3S — CID 103171510
2-amino-N,3,6-trimethyl-N-(oxan-4-ylmethyl)benzenesulfonamide (PubChem CID 103171510) has the molecular formula C15H24N2O3S and a molecular weight of 312.44 g/mol. Its IUPAC name is 2-amino-N,3,6-trimethyl-N-(oxan-4-ylmethyl)benzenesulfonamide.
| Compound Name | 2-amino-N,3,6-trimethyl-N-(oxan-4-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 103171510 |
| Molecular Formula | C15H24N2O3S |
| Molecular Weight | 312.44 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | 2-amino-N,3,6-trimethyl-N-(oxan-4-ylmethyl)benzenesulfonamide |
| SMILES | Cc1ccc(C)c(S(=O)(=O)N(C)CC2CCOCC2)c1N |
| InChI | InChI=1S/C15H24N2O3S/c1-11-4-5-12(2)15(14(11)16)21(18,19)17(3)10-13-6-8-20-9-7-13/h4-5,13H,6-10,16H2,1-3H3 |
| InChIKey | NINHJLQDBMQSTN-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.44 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|