C16H15N5O4S — CID 10317218
2-[[4-(carbamoylamino)phenyl]sulfonylmethyl]-1H-benzimidazole-4-carboxamide (PubChem CID 10317218) has the molecular formula C16H15N5O4S and a molecular weight of 373.39 g/mol. Its IUPAC name is 2-[[4-(carbamoylamino)phenyl]sulfonylmethyl]-1H-benzimidazole-4-carboxamide.
| Compound Name | 2-[[4-(carbamoylamino)phenyl]sulfonylmethyl]-1H-benzimidazole-4-carboxamide |
|---|---|
| PubChem CID | 10317218 |
| Molecular Formula | C16H15N5O4S |
| Molecular Weight | 373.39 g/mol |
| Exact Mass | 373.08 |
| IUPAC Name | 2-[[4-(carbamoylamino)phenyl]sulfonylmethyl]-1H-benzimidazole-4-carboxamide |
| SMILES | NC(=O)Nc1ccc(S(=O)(=O)Cc2nc3c(C(N)=O)cccc3[nH]2)cc1 |
| InChI | InChI=1S/C16H15N5O4S/c17-15(22)11-2-1-3-12-14(11)21-13(20-12)8-26(24,25)10-6-4-9(5-7-10)19-16(18)23/h1-7H,8H2,(H2,17,22)(H,20,21)(H3,18,19,23) |
| InChIKey | XWGNRJOKJSMIOE-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 161.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.39 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |