C12H23NO3S — CID 103174996
3-(2-ethyl-6-methylpiperidin-3-yl)oxythiolane 1,1-dioxide (PubChem CID 103174996) has the molecular formula C12H23NO3S and a molecular weight of 261.39 g/mol. Its IUPAC name is 3-(2-ethyl-6-methylpiperidin-3-yl)oxythiolane 1,1-dioxide.
| Compound Name | 3-(2-ethyl-6-methylpiperidin-3-yl)oxythiolane 1,1-dioxide |
|---|---|
| PubChem CID | 103174996 |
| Molecular Formula | C12H23NO3S |
| Molecular Weight | 261.39 g/mol |
| Exact Mass | 261.14 |
| IUPAC Name | 3-(2-ethyl-6-methylpiperidin-3-yl)oxythiolane 1,1-dioxide |
| SMILES | CCC1NC(C)CCC1OC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C12H23NO3S/c1-3-11-12(5-4-9(2)13-11)16-10-6-7-17(14,15)8-10/h9-13H,3-8H2,1-2H3 |
| InChIKey | LIIKZLNSAJWJIT-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.39 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |