C19H21FN4O2 — CID 1031755
(3R)-N-[(4-fluorophenyl)methyl]-1-(5-methylpyrazine-2-carbonyl)piperidine-3-carboxamide (PubChem CID 1031755) has the molecular formula C19H21FN4O2 and a molecular weight of 356.40 g/mol. Its IUPAC name is (3R)-N-[(4-fluorophenyl)methyl]-1-(5-methylpyrazine-2-carbonyl)piperidine-3-carboxamide.
| Compound Name | (3R)-N-[(4-fluorophenyl)methyl]-1-(5-methylpyrazine-2-carbonyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 1031755 |
| Molecular Formula | C19H21FN4O2 |
| Molecular Weight | 356.40 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | (3R)-N-[(4-fluorophenyl)methyl]-1-(5-methylpyrazine-2-carbonyl)piperidine-3-carboxamide |
| SMILES | Cc1cnc(C(=O)N2CCC[C@@H](C(=O)NCc3ccc(F)cc3)C2)cn1 |
| InChI | InChI=1S/C19H21FN4O2/c1-13-9-22-17(11-21-13)19(26)24-8-2-3-15(12-24)18(25)23-10-14-4-6-16(20)7-5-14/h4-7,9,11,15H,2-3,8,10,12H2,1H3,(H,23,25)/t15-/m1/s1 |
| InChIKey | RPUUDNWZFXXJNB-OAHLLOKOSA-N |
| XLogP | 2.09 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.40 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |