C14H24N2O3 — CID 103176909
1-[2-(3-methoxypropoxy)ethoxy]-1-pyridin-3-ylpropan-2-amine (PubChem CID 103176909) has the molecular formula C14H24N2O3 and a molecular weight of 268.36 g/mol. Its IUPAC name is 1-[2-(3-methoxypropoxy)ethoxy]-1-pyridin-3-ylpropan-2-amine.
| Compound Name | 1-[2-(3-methoxypropoxy)ethoxy]-1-pyridin-3-ylpropan-2-amine |
|---|---|
| PubChem CID | 103176909 |
| Molecular Formula | C14H24N2O3 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.18 |
| IUPAC Name | 1-[2-(3-methoxypropoxy)ethoxy]-1-pyridin-3-ylpropan-2-amine |
| SMILES | COCCCOCCOC(c1cccnc1)C(C)N |
| InChI | InChI=1S/C14H24N2O3/c1-12(15)14(13-5-3-6-16-11-13)19-10-9-18-8-4-7-17-2/h3,5-6,11-12,14H,4,7-10,15H2,1-2H3 |
| InChIKey | TZEHFPAHCLEZDS-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 66.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|