C14H25NO3S — CID 103176953
1-[2-(3-methoxypropoxy)ethoxy]-1-(3-methylthiophen-2-yl)propan-2-amine (PubChem CID 103176953) has the molecular formula C14H25NO3S and a molecular weight of 287.43 g/mol. Its IUPAC name is 1-[2-(3-methoxypropoxy)ethoxy]-1-(3-methylthiophen-2-yl)propan-2-amine.
| Compound Name | 1-[2-(3-methoxypropoxy)ethoxy]-1-(3-methylthiophen-2-yl)propan-2-amine |
|---|---|
| PubChem CID | 103176953 |
| Molecular Formula | C14H25NO3S |
| Molecular Weight | 287.43 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | 1-[2-(3-methoxypropoxy)ethoxy]-1-(3-methylthiophen-2-yl)propan-2-amine |
| SMILES | COCCCOCCOC(c1sccc1C)C(C)N |
| InChI | InChI=1S/C14H25NO3S/c1-11-5-10-19-14(11)13(12(2)15)18-9-8-17-7-4-6-16-3/h5,10,12-13H,4,6-9,15H2,1-3H3 |
| InChIKey | HXSOEVAAMLIZFM-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.43 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|