C14H25NO2S — CID 55232648
1-(3-methylthiophen-2-yl)-1-(2-propoxyethoxy)butan-2-amine (PubChem CID 55232648) has the molecular formula C14H25NO2S and a molecular weight of 271.43 g/mol. Its IUPAC name is 1-(3-methylthiophen-2-yl)-1-(2-propoxyethoxy)butan-2-amine.
| Compound Name | 1-(3-methylthiophen-2-yl)-1-(2-propoxyethoxy)butan-2-amine |
|---|---|
| PubChem CID | 55232648 |
| Molecular Formula | C14H25NO2S |
| Molecular Weight | 271.43 g/mol |
| Exact Mass | 271.16 |
| IUPAC Name | 1-(3-methylthiophen-2-yl)-1-(2-propoxyethoxy)butan-2-amine |
| SMILES | CCCOCCOC(c1sccc1C)C(N)CC |
| InChI | InChI=1S/C14H25NO2S/c1-4-7-16-8-9-17-13(12(15)5-2)14-11(3)6-10-18-14/h6,10,12-13H,4-5,7-9,15H2,1-3H3 |
| InChIKey | OJRBEGQJIODZGE-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.43 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|