C15H27NO2S — CID 112587258
1-[2-[(2-methylpropan-2-yl)oxy]ethoxy]-1-(3-methylthiophen-2-yl)butan-2-amine (PubChem CID 112587258) has the molecular formula C15H27NO2S and a molecular weight of 285.45 g/mol. Its IUPAC name is 1-[2-[(2-methylpropan-2-yl)oxy]ethoxy]-1-(3-methylthiophen-2-yl)butan-2-amine.
| Compound Name | 1-[2-[(2-methylpropan-2-yl)oxy]ethoxy]-1-(3-methylthiophen-2-yl)butan-2-amine |
|---|---|
| PubChem CID | 112587258 |
| Molecular Formula | C15H27NO2S |
| Molecular Weight | 285.45 g/mol |
| Exact Mass | 285.18 |
| IUPAC Name | 1-[2-[(2-methylpropan-2-yl)oxy]ethoxy]-1-(3-methylthiophen-2-yl)butan-2-amine |
| SMILES | CCC(N)C(OCCOC(C)(C)C)c1sccc1C |
| InChI | InChI=1S/C15H27NO2S/c1-6-12(16)13(14-11(2)7-10-19-14)17-8-9-18-15(3,4)5/h7,10,12-13H,6,8-9,16H2,1-5H3 |
| InChIKey | NNMXUDBTLAAKPX-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.45 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|