C11H17NO4S2 — CID 103177430
2-[2-[2-(3-methoxypropoxy)ethylsulfanyl]-1,3-thiazol-4-yl]acetic acid (PubChem CID 103177430) has the molecular formula C11H17NO4S2 and a molecular weight of 291.39 g/mol. Its IUPAC name is 2-[2-[2-(3-methoxypropoxy)ethylsulfanyl]-1,3-thiazol-4-yl]acetic acid.
| Compound Name | 2-[2-[2-(3-methoxypropoxy)ethylsulfanyl]-1,3-thiazol-4-yl]acetic acid |
|---|---|
| PubChem CID | 103177430 |
| Molecular Formula | C11H17NO4S2 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.06 |
| IUPAC Name | 2-[2-[2-(3-methoxypropoxy)ethylsulfanyl]-1,3-thiazol-4-yl]acetic acid |
| SMILES | COCCCOCCSc1nc(CC(=O)O)cs1 |
| InChI | InChI=1S/C11H17NO4S2/c1-15-3-2-4-16-5-6-17-11-12-9(8-18-11)7-10(13)14/h8H,2-7H2,1H3,(H,13,14) |
| InChIKey | JNCMRCYQLKSSJR-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|