C12H17NO2S2 — CID 107005987
2-(2-hept-6-enylsulfanyl-1,3-thiazol-4-yl)acetic acid (PubChem CID 107005987) has the molecular formula C12H17NO2S2 and a molecular weight of 271.41 g/mol. Its IUPAC name is 2-(2-hept-6-enylsulfanyl-1,3-thiazol-4-yl)acetic acid.
| Compound Name | 2-(2-hept-6-enylsulfanyl-1,3-thiazol-4-yl)acetic acid |
|---|---|
| PubChem CID | 107005987 |
| Molecular Formula | C12H17NO2S2 |
| Molecular Weight | 271.41 g/mol |
| Exact Mass | 271.07 |
| IUPAC Name | 2-(2-hept-6-enylsulfanyl-1,3-thiazol-4-yl)acetic acid |
| SMILES | C=CCCCCCSc1nc(CC(=O)O)cs1 |
| InChI | InChI=1S/C12H17NO2S2/c1-2-3-4-5-6-7-16-12-13-10(9-17-12)8-11(14)15/h2,9H,1,3-8H2,(H,14,15) |
| InChIKey | FJRJEKXKCMIUIY-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.41 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|