C15H25FN2O3 — CID 103180864
N-[[3-fluoro-2-[2-(3-methoxypropoxy)ethoxy]-4-pyridinyl]methyl]propan-2-amine (PubChem CID 103180864) has the molecular formula C15H25FN2O3 and a molecular weight of 300.37 g/mol. Its IUPAC name is N-[[3-fluoro-2-[2-(3-methoxypropoxy)ethoxy]-4-pyridinyl]methyl]propan-2-amine.
| Compound Name | N-[[3-fluoro-2-[2-(3-methoxypropoxy)ethoxy]-4-pyridinyl]methyl]propan-2-amine |
|---|---|
| PubChem CID | 103180864 |
| Molecular Formula | C15H25FN2O3 |
| Molecular Weight | 300.37 g/mol |
| Exact Mass | 300.18 |
| IUPAC Name | N-[[3-fluoro-2-[2-(3-methoxypropoxy)ethoxy]-4-pyridinyl]methyl]propan-2-amine |
| SMILES | COCCCOCCOc1nccc(CNC(C)C)c1F |
| InChI | InChI=1S/C15H25FN2O3/c1-12(2)18-11-13-5-6-17-15(14(13)16)21-10-9-20-8-4-7-19-3/h5-6,12,18H,4,7-11H2,1-3H3 |
| InChIKey | VXBRPLSFFVKJMP-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 52.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.37 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|