C15H23FN2O — CID 103189335
1-[2-[1-(dimethylamino)propan-2-yl-ethylamino]-6-fluorophenyl]ethanone (PubChem CID 103189335) has the molecular formula C15H23FN2O and a molecular weight of 266.36 g/mol. Its IUPAC name is 1-[2-[1-(dimethylamino)propan-2-yl-ethylamino]-6-fluorophenyl]ethanone.
| Compound Name | 1-[2-[1-(dimethylamino)propan-2-yl-ethylamino]-6-fluorophenyl]ethanone |
|---|---|
| PubChem CID | 103189335 |
| Molecular Formula | C15H23FN2O |
| Molecular Weight | 266.36 g/mol |
| Exact Mass | 266.18 |
| IUPAC Name | 1-[2-[1-(dimethylamino)propan-2-yl-ethylamino]-6-fluorophenyl]ethanone |
| SMILES | CCN(c1cccc(F)c1C(C)=O)C(C)CN(C)C |
| InChI | InChI=1S/C15H23FN2O/c1-6-18(11(2)10-17(4)5)14-9-7-8-13(16)15(14)12(3)19/h7-9,11H,6,10H2,1-5H3 |
| InChIKey | XSSZKHXAFXFTKJ-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.36 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |