C17H26FN3O2 — CID 86818346
1-[2-fluoro-6-[[2-hydroxy-3-(4-methylpiperazin-1-yl)propyl]-methylamino]phenyl]ethanone (PubChem CID 86818346) has the molecular formula C17H26FN3O2 and a molecular weight of 323.41 g/mol. Its IUPAC name is 1-[2-fluoro-6-[[2-hydroxy-3-(4-methylpiperazin-1-yl)propyl]-methylamino]phenyl]ethanone.
| Compound Name | 1-[2-fluoro-6-[[2-hydroxy-3-(4-methylpiperazin-1-yl)propyl]-methylamino]phenyl]ethanone |
|---|---|
| PubChem CID | 86818346 |
| Molecular Formula | C17H26FN3O2 |
| Molecular Weight | 323.41 g/mol |
| Exact Mass | 323.20 |
| IUPAC Name | 1-[2-fluoro-6-[[2-hydroxy-3-(4-methylpiperazin-1-yl)propyl]-methylamino]phenyl]ethanone |
| SMILES | CC(=O)c1c(F)cccc1N(C)CC(O)CN1CCN(C)CC1 |
| InChI | InChI=1S/C17H26FN3O2/c1-13(22)17-15(18)5-4-6-16(17)20(3)11-14(23)12-21-9-7-19(2)8-10-21/h4-6,14,23H,7-12H2,1-3H3 |
| InChIKey | LUWDAUUDDDHAIQ-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 47.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.41 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |