C14H18FNO — CID 63865522
1-[2-fluoro-6-[methyl-[(2-methylcyclopropyl)methyl]amino]phenyl]ethanone (PubChem CID 63865522) has the molecular formula C14H18FNO and a molecular weight of 235.30 g/mol. Its IUPAC name is 1-[2-fluoro-6-[methyl-[(2-methylcyclopropyl)methyl]amino]phenyl]ethanone.
| Compound Name | 1-[2-fluoro-6-[methyl-[(2-methylcyclopropyl)methyl]amino]phenyl]ethanone |
|---|---|
| PubChem CID | 63865522 |
| Molecular Formula | C14H18FNO |
| Molecular Weight | 235.30 g/mol |
| Exact Mass | 235.14 |
| IUPAC Name | 1-[2-fluoro-6-[methyl-[(2-methylcyclopropyl)methyl]amino]phenyl]ethanone |
| SMILES | CC(=O)c1c(F)cccc1N(C)CC1CC1C |
| InChI | InChI=1S/C14H18FNO/c1-9-7-11(9)8-16(3)13-6-4-5-12(15)14(13)10(2)17/h4-6,9,11H,7-8H2,1-3H3 |
| InChIKey | PDELLGSFSBDWBU-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.30 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |